CymitQuimica logo

CAS 1263094-59-2

:

2-Pyridinemethanamine, 6-chloro-α-ethyl-, hydrochloride (1:1), (αS)-

Description:
2-Pyridinemethanamine, 6-chloro-α-ethyl-, hydrochloride (1:1), (αS)- is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features an ethyl group and a chloro substituent at specific positions on the pyridine ring, contributing to its unique reactivity and potential biological activity. As a hydrochloride salt, it is typically more soluble in water than its free base form, which is advantageous for various applications, including pharmaceutical formulations. The (αS)- designation indicates a specific stereochemistry, suggesting that the compound may exhibit chiral properties, potentially influencing its interaction with biological systems. Its CAS number, 1263094-59-2, allows for precise identification in chemical databases. Overall, this compound may be of interest in medicinal chemistry and drug development due to its structural features and potential pharmacological effects.
Formula:C8H11ClN2·ClH
InChI:InChI=1S/C8H11ClN2.ClH/c1-2-6(10)7-4-3-5-8(9)11-7;/h3-6H,2,10H2,1H3;1H/t6-;/m0./s1
InChI key:InChIKey=RJNKVKYBUFSNLR-RGMNGODLSA-N
SMILES:[C@@H](CC)(N)C=1N=C(Cl)C=CC1.Cl
Synonyms:
  • 2-Pyridinemethanamine, 6-chloro-α-ethyl-, hydrochloride (1:1), (αS)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.