CymitQuimica logo

CAS 126310-27-8

:

6H-Pyrrolo[3,4-b]pyrazine-6-acetic acid, 5,7-dihydro-α-methyl-5,7-dioxo-, (S)-

Description:
6H-Pyrrolo[3,4-b]pyrazine-6-acetic acid, 5,7-dihydro-α-methyl-5,7-dioxo-, (S)-, with CAS number 126310-27-8, is a heterocyclic organic compound characterized by its complex bicyclic structure that incorporates both pyrrole and pyrazine moieties. This compound features a carboxylic acid functional group, which contributes to its acidity and potential reactivity. The presence of the α-methyl group and the dioxo substituents indicates that it may exhibit unique steric and electronic properties, influencing its biological activity and interactions. The (S)- designation suggests that it exists as a specific enantiomer, which can be crucial for its pharmacological effects, as chirality often plays a significant role in the behavior of biological molecules. This compound may be of interest in medicinal chemistry and drug development, particularly in the context of its potential therapeutic applications. Its solubility, stability, and reactivity would depend on the specific conditions and solvents used in experimentation or formulation.
Formula:C9H7N3O4
InChI:InChI=1S/C9H7N3O4/c1-4(9(15)16)12-7(13)5-6(8(12)14)11-3-2-10-5/h2-4H,1H3,(H,15,16)/t4-/m0/s1
InChI key:InChIKey=ZFZJOLSXTGOSGC-BYPYZUCNSA-N
SMILES:[C@@H](C(O)=O)(C)N1C(=O)C=2C(C1=O)=NC=CN2
Synonyms:
  • 6H-Pyrrolo[3,4-b]pyrazine-6-acetic acid, 5,7-dihydro-α-methyl-5,7-dioxo-, (S)-
  • (2S)-2-(5,7-Dioxopyrrolo[3,4-b]pyrazin-6-yl)propanoic acid
  • (2S)-2-[5,7-Dioxo-5H,6H,7H-pyrrolo[3,4-b]pyrazin-6-yl]propanoic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.