CAS 1263178-48-8

3-(2-Bromo-4-thiazolyl)-1-indolizinecarboxylic acid

Description:

3-(2-Bromo-4-thiazolyl)-1-indolizinecarboxylic acid is a chemical compound characterized by its unique structural features, which include an indolizine core and a thiazole ring. The presence of a bromine atom at the 2-position of the thiazole contributes to its reactivity and potential biological activity. This compound is likely to exhibit properties typical of heterocyclic compounds, such as varied solubility in organic solvents and potential interactions with biological targets due to its functional groups. The carboxylic acid moiety suggests acidity and the ability to form salts or esters, which can influence its pharmacological properties. Additionally, the compound may possess interesting optical properties due to the conjugated system formed by the indolizine and thiazole rings. Its specific applications could range from medicinal chemistry to materials science, depending on its biological activity and stability. As with many heterocycles, the synthesis and characterization of this compound would be crucial for understanding its potential uses in various fields.

Formula: C₁₂H₇BrN₂O₂S

InChI: InChI=1S/C12H7BrN2O2S/c13-12-14-8(6-18-12)10-5-7(11(16)17)9-3-1-2-4-15(9)10/h1-6H,(H,16,17)

InChI key: InChIKey=LWLQEGNKYLWILO-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C=C(N2C1C=CC=C2)C=3N=C(Br)SC3

Synonyms:

• 3-(2-Bromo-4-thiazolyl)-1-indolizinecarboxylic acid
• 1-Indolizinecarboxylic acid, 3-(2-bromo-4-thiazolyl)-