CAS 1263180-54-6

4-Chloro[1,2,4]triazolo[1,5-a]quinoxaline-2-carboxylic acid

Description:

4-Chloro[1,2,4]triazolo[1,5-a]quinoxaline-2-carboxylic acid is a heterocyclic compound characterized by its unique triazole and quinoxaline structures. This compound features a chloro substituent at the 4-position of the triazole ring and a carboxylic acid functional group at the 2-position of the quinoxaline moiety. It is typically a crystalline solid, exhibiting moderate solubility in polar solvents due to the presence of the carboxylic acid group, which can engage in hydrogen bonding. The compound is of interest in medicinal chemistry and material science, often studied for its potential biological activities, including antimicrobial and anticancer properties. Its molecular structure allows for various chemical modifications, which can enhance its pharmacological profile. Additionally, the presence of the triazole ring contributes to its stability and reactivity, making it a valuable scaffold in drug design. As with many heterocycles, the compound's properties can be influenced by factors such as pH and solvent environment, which are important considerations in both laboratory and industrial applications.

Formula: C₁₀H₅ClN₄O₂

InChI: InChI=1S/C10H5ClN4O2/c11-7-9-13-8(10(16)17)14-15(9)6-4-2-1-3-5(6)12-7/h1-4H,(H,16,17)

InChI key: InChIKey=WOZBIMTXLAYVPU-UHFFFAOYSA-N

SMILES: ClC=1C=2N(C=3C(N1)=CC=CC3)N=C(C(O)=O)N2

Synonyms:

• 4-Chloro[1,2,4]triazolo[1,5-a]quinoxaline-2-carboxylic acid
• [1,2,4]Triazolo[1,5-a]quinoxaline-2-carboxylic acid, 4-chloro-
• 4-Chloro-[1,2,4]Triazolo[1,5-A]Quinoxaline-2-Carboxylic Acid(WX135067)