CAS 1263181-92-5

2,2-Difluoro-7-aza-spiro[3.5]nonane

Description:

2,2-Difluoro-7-aza-spiro[3.5]nonane is a chemical compound characterized by its unique spirocyclic structure, which features a nitrogen atom integrated into a bicyclic framework. The presence of two fluorine atoms at the 2-position contributes to its distinctive reactivity and potential applications in medicinal chemistry and material science. The aza-spiro structure enhances its conformational rigidity, which can influence its biological activity and interaction with various targets. This compound may exhibit interesting properties such as altered lipophilicity and solubility due to the fluorine substituents, making it a subject of interest in drug design. Additionally, the spiro configuration can lead to unique stereochemical properties, which are crucial in the development of pharmaceuticals. As with many fluorinated compounds, 2,2-Difluoro-7-aza-spiro[3.5]nonane may also demonstrate enhanced metabolic stability, making it a valuable candidate for further research in synthetic and medicinal chemistry.

Formula: C₈H₁₄ClF₂N

InChI: InChI=1S/C8H13F2N.ClH/c9-8(10)5-7(6-8)1-3-11-4-2-7;/h11H,1-6H2;1H

SMILES: C1CNCCC21CC(C2)(F)F.Cl

Synonyms:

• 2,2-Difluoro-7-Azaspiro[3.5]Nonane
• 2,2-Difluoro-7-aza-spiro[3.5]nonane hydrochloride
• 2,2-Difluoro-7-azaspiro[3.5]nonane hydrochloride (1:1)
• 2,2-Difluoro-7-aza-spiro[3.5]nonane

2,2-Difluoro-7-aza-spiro[3.5]nonane hydrochloride

CAS: 1263181-92-5

Formula: C₈H₁₃F₂N

Molecular weight: 161.1923

Ref: IN-DA000SKB