CymitQuimica logo

CAS 126320-56-7

:

1,4,8,11-Tetrakis(diethylaminocarbonylmethyl)-1,4,8,11-tetraazacyclotetradecane

Description:
1,4,8,11-Tetrakis(diethylaminocarbonylmethyl)-1,4,8,11-tetraazacyclotetradecane is a complex organic compound characterized by its tetracyclic structure, which includes four nitrogen atoms integrated into a macrocyclic framework. This compound features multiple diethylaminocarbonylmethyl substituents, which enhance its solubility and reactivity. The presence of these functional groups suggests potential applications in coordination chemistry, particularly in the formation of metal complexes. The compound's structure allows for the possibility of chelation, making it of interest in fields such as catalysis and materials science. Additionally, the diethylamino groups may impart unique electronic properties, influencing the compound's behavior in various chemical environments. Its CAS number, 126320-56-7, facilitates its identification in chemical databases, aiding researchers in accessing relevant literature and safety data. Overall, this compound exemplifies the intricate design of ligands in coordination chemistry, with potential implications in drug delivery systems and the development of novel materials.
Formula:C34H68N8O4
InChI:InChI=1/C34H68N8O4/c1-9-39(10-2)31(43)27-35-19-17-20-37(29-33(45)41(13-5)14-6)25-26-38(30-34(46)42(15-7)16-8)22-18-21-36(24-23-35)28-32(44)40(11-3)12-4/h9-30H2,1-8H3
SMILES:CCN(CC)C(=O)CN1CCCN(CCN(CCCN(CC1)CC(=O)N(CC)CC)CC(=O)N(CC)CC)CC(=O)N(CC)CC
Synonyms:
  • N,N-diethyl-2-[4,8,11-tris(2-diethylamino-2-oxo-ethyl)-1,4,8,11-tetrazacyclotetradec-1-yl]acetamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.