CAS 126320-57-8: 1,4,8,11-Tetraethyl 1,4,8,11-tetraazacyclotetradecane-1,4,8,11-tetraacetate
Description:1,4,8,11-Tetraethyl 1,4,8,11-tetraazacyclotetradecane-1,4,8,11-tetraacetate, with CAS number 126320-57-8, is a complex organic compound characterized by its cyclic structure and multiple functional groups. This substance features a tetraazacyclotetradecane backbone, which consists of a 14-membered ring containing four nitrogen atoms, contributing to its chelating properties. The presence of tetraethyl and tetraacetate groups enhances its solubility and reactivity, making it suitable for various applications in coordination chemistry and potentially in drug delivery systems. The compound's structure allows for the formation of stable complexes with metal ions, which can be utilized in catalysis or as contrast agents in medical imaging. Additionally, the presence of acetyl groups may influence its biological activity and interaction with biomolecules. Overall, this compound exemplifies the intricate relationship between molecular structure and function, highlighting its potential utility in both industrial and pharmaceutical contexts.
Formula:C26H48N4O8
InChI:InChI=1S/C26H48N4O8/c1-5-35-23(31)19-27-11-9-12-29(21-25(33)37-7-3)17-18-30(22-26(34)38-8-4)14-10-13-28(16-15-27)20-24(32)36-6-2/h5-22H2,1-4H3
InChI key:InChIKey=HGPDBLIYOCNCEH-UHFFFAOYSA-N
SMILES:O=C(OCC)CN1CCN(CC(=O)OCC)CCCN(CC(=O)OCC)CCN(CC(=O)OCC)CCC1
- Synonyms:
- 1,4,8,11-Tetraazacyclotetradecane-1,4,8,11-tetraacetic Acid Tetraethyl Ester
- 1,4,8,11-Tetraazacyclotetradecane-1,4,8,11-tetraacetic acid, 1,4,8,11-tetraethyl ester
- 1,4,8,11-Tetraazacyclotetradecane-N,N',N',N''-tetraacetic acid, tetraethyl ester, min. 98%
- 1,4,8,11-Tetraethyl 1,4,8,11-tetraazacyclotetradecane-1,4,8,11-tetraacetate
- Ethyl 2-[4,8,11-Tris(2-Ethoxy-2-Oxo-Ethyl)-1,4,8,11-Tetrazacyclotetradec-1-Yl]Acetate
- Tetraethyl 1,4,8,11-Tetraazacyclotetradecane-1,4,8,11-tetraacetate
- 1,4,8,11-Tetrakis(ethoxycarbonylmethyl)-1,4,8,11-tetraazacyclotetradecane