
CAS 1263209-12-6
:1-(4-Aminobenzoyl)-2-imidazolidinone
Description:
1-(4-Aminobenzoyl)-2-imidazolidinone is a chemical compound characterized by its unique structure, which includes an imidazolidinone ring and an amine group attached to a benzoyl moiety. This compound typically exhibits properties such as solubility in polar solvents, which is common for many amine-containing compounds. Its molecular structure suggests potential applications in pharmaceuticals, particularly in drug design, due to the presence of functional groups that can participate in various chemical reactions. The amine group may contribute to its basicity, while the carbonyl group in the imidazolidinone can engage in hydrogen bonding, influencing its reactivity and interaction with biological targets. Additionally, the compound may exhibit specific biological activities, making it of interest in medicinal chemistry. However, detailed information regarding its toxicity, stability, and specific applications would require further investigation through experimental studies and literature reviews. Overall, 1-(4-Aminobenzoyl)-2-imidazolidinone represents a versatile scaffold for further research and development in chemical and pharmaceutical contexts.
Formula:C10H11N3O2
InChI:InChI=1S/C10H11N3O2/c11-8-3-1-7(2-4-8)9(14)13-6-5-12-10(13)15/h1-4H,5-6,11H2,(H,12,15)
InChI key:InChIKey=OYKRTSCEKPWHLD-UHFFFAOYSA-N
SMILES:C(=O)(N1C(=O)NCC1)C2=CC=C(N)C=C2
Synonyms:- 1-(4-Aminobenzoyl)-2-imidazolidinone
- 2-Imidazolidinone, 1-(4-aminobenzoyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.