
CAS 1263211-33-1
:3-Ethyl-6-methylisoxazolo[5,4-b]pyridine-4-carboxylic acid
Description:
3-Ethyl-6-methylisoxazolo[5,4-b]pyridine-4-carboxylic acid is a heterocyclic compound characterized by its unique bicyclic structure that incorporates both isoxazole and pyridine rings. This compound features an ethyl group and a methyl group, which contribute to its hydrophobic characteristics, potentially influencing its solubility and reactivity. The presence of a carboxylic acid functional group indicates that it can participate in acid-base reactions, making it a potential candidate for various chemical syntheses and biological applications. The isoxazole moiety is known for its role in medicinal chemistry, often exhibiting biological activity, while the pyridine ring can enhance the compound's electron-withdrawing properties. Overall, this compound's structural features suggest it may have applications in pharmaceuticals or agrochemicals, although specific biological activities and properties would require further investigation through experimental studies.
Formula:C10H10N2O3
InChI:InChI=1S/C10H10N2O3/c1-3-7-8-6(10(13)14)4-5(2)11-9(8)15-12-7/h4H,3H2,1-2H3,(H,13,14)
InChI key:InChIKey=NXIMYQMGSWHRMT-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C2C(ON=C2CC)=NC(C)=C1
Synonyms:- Isoxazolo[5,4-b]pyridine-4-carboxylic acid, 3-ethyl-6-methyl-
- 3-Ethyl-6-methylisoxazolo[5,4-b]pyridine-4-carboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.