CymitQuimica logo

CAS 1263211-61-5

:

5-Methoxy-1-(2-methoxyethyl)-1H-pyrazole-3-carboxylic acid

Description:
5-Methoxy-1-(2-methoxyethyl)-1H-pyrazole-3-carboxylic acid is a chemical compound characterized by its pyrazole core, which is a five-membered ring containing two nitrogen atoms. This compound features a methoxy group and a carboxylic acid functional group, contributing to its potential reactivity and solubility in various solvents. The presence of the methoxyethyl substituent enhances its lipophilicity, which may influence its biological activity and pharmacokinetic properties. As a carboxylic acid, it can participate in acid-base reactions and form salts or esters. The compound's structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the pyrazole moiety's known biological activities. Additionally, the specific arrangement of substituents may affect its interaction with biological targets, making it a subject of interest for further research. However, detailed studies on its toxicity, stability, and specific applications would be necessary to fully understand its characteristics and potential uses.
Formula:C8H12N2O4
InChI:InChI=1S/C8H12N2O4/c1-13-4-3-10-7(14-2)5-6(9-10)8(11)12/h5H,3-4H2,1-2H3,(H,11,12)
InChI key:InChIKey=VOAHOFQSZSDVCJ-UHFFFAOYSA-N
SMILES:C(COC)N1C(OC)=CC(C(O)=O)=N1
Synonyms:
  • 1H-Pyrazole-3-carboxylic acid, 5-methoxy-1-(2-methoxyethyl)-
  • 5-Methoxy-1-(2-methoxyethyl)-1H-pyrazole-3-carboxylic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.