CAS 1263212-05-0

Methyl 1-[(3,5-dimethyl-1H-pyrazol-1-yl)methyl]-5-methyl-1H-pyrazole-3-carboxylate

Description:

Methyl 1-[(3,5-dimethyl-1H-pyrazol-1-yl)methyl]-5-methyl-1H-pyrazole-3-carboxylate is a chemical compound characterized by its complex structure, which includes multiple pyrazole rings and a carboxylate functional group. This compound typically exhibits properties associated with pyrazole derivatives, such as potential biological activity, including anti-inflammatory or anti-cancer effects, due to the presence of the pyrazole moiety. It is likely to be a solid at room temperature, with moderate solubility in organic solvents, reflecting the presence of both hydrophobic and polar functional groups. The methyl ester group contributes to its reactivity, making it a potential candidate for further chemical modifications. Additionally, the presence of multiple methyl groups can influence its lipophilicity and overall stability. As with many pyrazole derivatives, it may also exhibit interesting interactions with biological targets, making it of interest in medicinal chemistry and drug development. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity.

Formula: C₁₂H₁₆N₄O₂

InChI: InChI=1S/C12H16N4O2/c1-8-5-9(2)15(13-8)7-16-10(3)6-11(14-16)12(17)18-4/h5-6H,7H2,1-4H3

InChI key: InChIKey=ZLANWALFUDAYAP-UHFFFAOYSA-N

SMILES: C(N1N=C(C(OC)=O)C=C1C)N2C(C)=CC(C)=N2

Synonyms:

• 1H-Pyrazole-3-carboxylic acid, 1-[(3,5-dimethyl-1H-pyrazol-1-yl)methyl]-5-methyl-, methyl ester
• Methyl 1-[(3,5-dimethyl-1H-pyrazol-1-yl)methyl]-5-methyl-1H-pyrazole-3-carboxylate