CAS 1263212-95-8

2,3-Dihydro-8-(2,2,2-trifluoroacetyl)imidazo[1,2-a]pyridin-5(1H)-one

Description:

2,3-Dihydro-8-(2,2,2-trifluoroacetyl)imidazo[1,2-a]pyridin-5(1H)-one is a heterocyclic organic compound characterized by its imidazopyridine structure, which incorporates both nitrogen and carbon atoms in its ring system. This compound features a dihydro form, indicating the presence of additional hydrogen atoms that contribute to its saturation. The trifluoroacetyl group attached to the imidazo ring enhances its reactivity and polarity, making it a potential candidate for various chemical reactions and applications in medicinal chemistry. The presence of fluorine atoms typically imparts unique electronic properties, potentially influencing the compound's biological activity and solubility. Additionally, the imidazopyridine framework is known for its diverse pharmacological properties, including antimicrobial and anti-inflammatory activities. The compound's specific characteristics, such as melting point, solubility, and spectral properties, would be determined through experimental methods, which are essential for understanding its behavior in different environments and potential applications in drug development or material science.

Formula: C₉H₇F₃N₂O₂

InChI: InChI=1S/C9H7F3N2O2/c10-9(11,12)7(16)5-1-2-6(15)14-4-3-13-8(5)14/h1-2,13H,3-4H2

InChI key: InChIKey=YPEFAWWLGKVSOS-UHFFFAOYSA-N

SMILES: C(C(F)(F)F)(=O)C1=C2N(C(=O)C=C1)CCN2

Synonyms:

• 2,3-Dihydro-8-(2,2,2-trifluoroacetyl)imidazo[1,2-a]pyridin-5(1H)-one
• Imidazo[1,2-a]pyridin-5(1H)-one, 2,3-dihydro-8-(2,2,2-trifluoroacetyl)-