
CAS 1263213-65-5
:Methyl 5-bromo-2,3-dihydro-3,3-dimethyl-2-oxo-1H-indole-1-acetate
Description:
Methyl 5-bromo-2,3-dihydro-3,3-dimethyl-2-oxo-1H-indole-1-acetate is a chemical compound characterized by its complex indole structure, which includes a bromine substituent and an acetate group. This compound features a dihydroindole framework, indicating it has a saturated ring system, and the presence of a ketone functional group contributes to its reactivity and potential applications in organic synthesis. The methyl groups attached to the indole structure enhance its lipophilicity, which may influence its biological activity. The bromine atom can serve as a site for further chemical modifications, making it a versatile intermediate in synthetic chemistry. Additionally, the acetate moiety can participate in esterification reactions, further expanding its utility in various chemical transformations. Overall, this compound's unique structural features suggest potential applications in medicinal chemistry and material science, although specific biological activities and properties would require further investigation.
Formula:C13H14BrNO3
InChI:InChI=1S/C13H14BrNO3/c1-13(2)9-6-8(14)4-5-10(9)15(12(13)17)7-11(16)18-3/h4-6H,7H2,1-3H3
InChI key:InChIKey=YOXBSYDJZUTCQU-UHFFFAOYSA-N
SMILES:C(C(OC)=O)N1C=2C(C(C)(C)C1=O)=CC(Br)=CC2
Synonyms:- 1H-Indole-1-acetic acid, 5-bromo-2,3-dihydro-3,3-dimethyl-2-oxo-, methyl ester
- Methyl 5-bromo-2,3-dihydro-3,3-dimethyl-2-oxo-1H-indole-1-acetate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.