CAS 1263213-94-0

1-[(4-Nitro-1H-pyrazol-1-yl)methyl]-1H-pyrazole-3-carboxylic acid hydrazide

Description:

1-[(4-Nitro-1H-pyrazol-1-yl)methyl]-1H-pyrazole-3-carboxylic acid hydrazide is a chemical compound characterized by its complex structure, which includes a pyrazole ring and a hydrazide functional group. This compound features a nitro group at the 4-position of one pyrazole ring, contributing to its potential reactivity and biological activity. The presence of the carboxylic acid moiety enhances its solubility in polar solvents and may influence its interaction with biological targets. The hydrazide functional group can participate in various chemical reactions, including hydrazone formation and potential applications in medicinal chemistry. This compound may exhibit interesting pharmacological properties, making it a subject of research in drug development. Its molecular structure suggests potential applications in agrochemicals or pharmaceuticals, particularly in the development of agents with antimicrobial or anti-inflammatory properties. As with many pyrazole derivatives, the compound's activity and stability can be influenced by substituents and the overall electronic environment of the molecule.

Formula: C₈H₉N₇O₃

InChI: InChI=1S/C8H9N7O3/c9-11-8(16)7-1-2-13(12-7)5-14-4-6(3-10-14)15(17)18/h1-4H,5,9H2,(H,11,16)

InChI key: InChIKey=UTLHJPLTBLXVHA-UHFFFAOYSA-N

SMILES: C(N1N=C(C(NN)=O)C=C1)N2C=C(N(=O)=O)C=N2

Synonyms:

• 1-[(4-Nitro-1H-pyrazol-1-yl)methyl]-1H-pyrazole-3-carboxylic acid hydrazide
• 1H-Pyrazole-3-carboxylic acid, 1-[(4-nitro-1H-pyrazol-1-yl)methyl]-, hydrazide