
CAS 126325-49-3
:4,6-Dibromo-2-methyl-3-pyridinamine
Description:
4,6-Dibromo-2-methyl-3-pyridinamine, with the CAS number 126325-49-3, is an organic compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features two bromine substituents at the 4 and 6 positions and a methyl group at the 2 position of the pyridine ring, along with an amino group at the 3 position. The presence of bromine atoms contributes to its reactivity and potential applications in various chemical reactions, including electrophilic substitution. The amino group enhances its solubility in polar solvents and may participate in hydrogen bonding, influencing its biological activity. This compound may be of interest in medicinal chemistry and materials science due to its unique structural features. Additionally, its synthesis and characterization would typically involve standard organic chemistry techniques, and it may exhibit specific properties such as melting point, boiling point, and spectral characteristics that are relevant for its identification and application in research.
Formula:C6H6Br2N2
InChI:InChI=1S/C6H6Br2N2/c1-3-6(9)4(7)2-5(8)10-3/h2H,9H2,1H3
InChI key:InChIKey=MCKJQNQVJYGYOE-UHFFFAOYSA-N
SMILES:NC=1C(Br)=CC(Br)=NC1C
Synonyms:- 4,6-Dibromo-2-methyl-3-pyridinamine
- 3-Pyridinamine, 4,6-dibromo-2-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.