CAS 126325-51-7

2,6-Dibromo-5-methyl-3-pyridinamine

Description:

2,6-Dibromo-5-methyl-3-pyridinamine is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing nitrogen. The presence of two bromine substituents at the 2 and 6 positions, along with a methyl group at the 5 position and an amino group at the 3 position, contributes to its unique chemical properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the amino group, which can engage in hydrogen bonding. The bromine atoms enhance its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and coupling reactions. Additionally, the presence of the amino group suggests potential applications in pharmaceuticals or agrochemicals, as amines are often key functional groups in biologically active compounds. Safety data should be consulted for handling, as halogenated compounds can pose environmental and health risks.

Formula: C₆H₆Br₂N₂

InChI: InChI=1S/C6H6Br2N2/c1-3-2-4(9)6(8)10-5(3)7/h2H,9H2,1H3

InChI key: InChIKey=YAXIPDBNGXJHKM-UHFFFAOYSA-N

SMILES: CC1=C(Br)N=C(Br)C(N)=C1

Synonyms:

• 3-Amino-2,6-dibromo-5-methylpyridine
• 2,6-Dibromo-5-methyl-3-pyridinamine
• 3-Pyridinamine, 2,6-dibromo-5-methyl-