CymitQuimica logo

CAS 126325-52-8

:

2,4,6-Tribromo-5-methyl-3-pyridinamine

Description:
2,4,6-Tribromo-5-methyl-3-pyridinamine is an organic compound characterized by its brominated pyridine structure. It features three bromine atoms attached to the 2, 4, and 6 positions of the pyridine ring, along with a methyl group at the 5 position and an amino group at the 3 position. This compound is typically a solid at room temperature and may exhibit a range of colors depending on its purity and form. It is known for its potential applications in pharmaceuticals and agrochemicals due to the presence of both the bromine substituents, which can enhance biological activity, and the amino group, which can participate in various chemical reactions. The presence of multiple halogen atoms often contributes to its reactivity and stability under certain conditions. Additionally, its molecular structure suggests that it may have specific interactions with biological targets, making it of interest in medicinal chemistry. Safety data should be consulted, as brominated compounds can pose environmental and health risks.
Formula:C6H5Br3N2
InChI:InChI=1S/C6H5Br3N2/c1-2-3(7)4(10)6(9)11-5(2)8/h10H2,1H3
InChI key:InChIKey=XODVRXKJCGCDSF-UHFFFAOYSA-N
SMILES:CC=1C(Br)=C(N)C(Br)=NC1Br
Synonyms:
  • 3-Amino-2,4,6-tribromo-5-methylpyridine
  • 3-Pyridinamine, 2,4,6-tribromo-5-methyl-
  • 2,4,6-Tribromo-5-methyl-3-pyridinamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.