CAS 126325-54-0

4-Amino-3,5-dibromo-2-methylpyridine

Description:

4-Amino-3,5-dibromo-2-methylpyridine is a heterocyclic organic compound characterized by a pyridine ring substituted with amino and bromine groups, as well as a methyl group. The presence of the amino group (-NH2) contributes to its basicity and potential reactivity in various chemical reactions, such as nucleophilic substitutions. The dibromo substitutions at the 3 and 5 positions enhance its electrophilic character, making it useful in synthetic organic chemistry. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the amino group. Its bromine atoms can participate in further chemical transformations, such as cross-coupling reactions. Additionally, the methyl group at the 2 position can influence the compound's steric and electronic properties, affecting its reactivity and interactions with other molecules. Overall, 4-Amino-3,5-dibromo-2-methylpyridine is of interest in pharmaceutical and agrochemical research due to its potential applications in drug development and as a building block in organic synthesis.

Formula: C₆H₆Br₂N₂

InChI: InChI=1/C6H6Br2N2/c1-3-5(8)6(9)4(7)2-10-3/h2H,1H3,(H2,9,10)

Synonyms:

• 3,5-Dibromo-2-methylpyridin-4-amine
• 4-pyridinamine, 3,5-dibromo-2-methyl-

4-Pyridinamine, 3,5-dibromo-2-methyl-

CAS: 126325-54-0

Formula: C₆H₆Br₂N₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 265.9332

Ref: IN-DA000SKE

3,5-Dibromo-2-methylpyridin-4-amine

CAS: 126325-54-0

3,5-Dibromo-2-methylpyridin-4-amine

Purity: 95%

Molecular weight: 265.93g/mol

Ref: 54-OR77200

3,5-Dibromo-2-methylpyridin-4-amine

CAS: 126325-54-0

Purity: 95%

Molecular weight: 265.9360046

Ref: 10-F640037

3,5-Dibromo-2-methylpyridin-4-amine

CAS: 126325-54-0

Versatile small molecule scaffold

Formula: C₆H₆Br₂N₂

Purity: Min. 95%

Molecular weight: 265.94 g/mol

Ref: 3D-BFA32554