CAS 1263274-75-4

2,3-Difluoro-N-methylbenzenesulfonamide

Description:

2,3-Difluoro-N-methylbenzenesulfonamide is a chemical compound characterized by the presence of a sulfonamide functional group attached to a benzene ring that is further substituted with two fluorine atoms and a methyl group. The fluorine atoms are located at the 2 and 3 positions of the benzene ring, which can influence the compound's reactivity and polarity. The sulfonamide group contributes to its potential as a pharmacophore in medicinal chemistry, often enhancing solubility and biological activity. This compound may exhibit properties such as moderate to high stability under standard conditions, and its fluorinated nature can impart unique characteristics, such as increased lipophilicity and altered electronic properties. The presence of the methyl group can also affect steric hindrance and overall molecular conformation. Due to these features, 2,3-Difluoro-N-methylbenzenesulfonamide may be of interest in various applications, including pharmaceuticals and agrochemicals, although specific biological activities and interactions would require further investigation.

Formula: C₇H₇F₂NO₂S

InChI: InChI=1S/C7H7F2NO2S/c1-10-13(11,12)6-4-2-3-5(8)7(6)9/h2-4,10H,1H3

InChI key: InChIKey=IQPIKZLGDDXKBF-UHFFFAOYSA-N

SMILES: S(NC)(=O)(=O)C1=C(F)C(F)=CC=C1

Synonyms:

• Benzenesulfonamide, 2,3-difluoro-N-methyl-
• 2,3-Difluoro-N-methylbenzenesulfonamide