CAS 1263277-39-9

2,5-Difluoro-4-methylbenzamide

Description:

2,5-Difluoro-4-methylbenzamide is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with two fluorine atoms and a methyl group, as well as an amide functional group. The presence of the difluoro substituents at the 2 and 5 positions of the benzene ring significantly influences its chemical properties, including its reactivity and polarity. The methyl group at the para position (4) contributes to the overall hydrophobic character of the molecule. This compound is likely to exhibit moderate solubility in polar solvents due to the amide group, which can engage in hydrogen bonding. Additionally, the fluorine atoms can enhance the compound's stability and alter its electronic properties, making it of interest in various applications, including pharmaceuticals and agrochemicals. Its unique combination of functional groups may also lead to specific interactions in biological systems, warranting further investigation into its potential uses and effects.

Formula: C₈H₇F₂NO

InChI: InChI=1S/C8H7F2NO/c1-4-2-7(10)5(8(11)12)3-6(4)9/h2-3H,1H3,(H2,11,12)

InChI key: InChIKey=WVMBYOLGRPYBAU-UHFFFAOYSA-N

SMILES: C(N)(=O)C1=C(F)C=C(C)C(F)=C1

Synonyms:

• 2,5-Difluoro-4-methylbenzamide
• Benzamide, 2,5-difluoro-4-methyl-