CymitQuimica logo

CAS 1263282-75-2

:

α-(Aminomethyl)-3-nitrobenzeneacetic acid

Description:
α-(Aminomethyl)-3-nitrobenzeneacetic acid, identified by its CAS number 1263282-75-2, is a chemical compound that features both amino and nitro functional groups, which contribute to its reactivity and potential applications in various fields. This compound typically exhibits characteristics such as being a solid at room temperature, with a specific melting point and solubility profile that may vary depending on the solvent used. The presence of the nitro group suggests that it may participate in electrophilic aromatic substitution reactions, while the amino group can engage in hydrogen bonding, influencing its solubility and interaction with biological systems. Additionally, the compound may exhibit biological activity, making it of interest in pharmaceutical research. Its structural features indicate potential for use in the synthesis of more complex molecules or as a precursor in organic synthesis. Safety data should be consulted for handling and storage, as compounds with nitro and amino groups can have specific hazards associated with them.
Formula:C9H10N2O4
InChI:InChI=1S/C9H10N2O4/c10-5-8(9(12)13)6-2-1-3-7(4-6)11(14)15/h1-4,8H,5,10H2,(H,12,13)
InChI key:InChIKey=VODQZOBRLBSVGX-UHFFFAOYSA-N
SMILES:C(C(O)=O)(CN)C1=CC(N(=O)=O)=CC=C1
Synonyms:
  • α-(Aminomethyl)-3-nitrobenzeneacetic acid
  • Benzeneacetic acid, α-(aminomethyl)-3-nitro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.