CymitQuimica logo

CAS 1263283-70-0

:

5-[3-[[(1,1-Dimethylethoxy)carbonyl]amino]phenyl]-3-isoxazolecarboxylic acid

Description:
5-[3-[[(1,1-Dimethylethoxy)carbonyl]amino]phenyl]-3-isoxazolecarboxylic acid is a chemical compound characterized by its complex structure, which includes an isoxazole ring and an amino group attached to a phenyl group. This compound features a dimethylethoxycarbonyl group, which contributes to its stability and solubility properties. The presence of the carboxylic acid functional group indicates that it can participate in acid-base reactions, making it potentially useful in various chemical syntheses and biological applications. The isoxazole moiety is known for its role in medicinal chemistry, often exhibiting biological activity. The compound's molecular structure suggests it may have applications in pharmaceuticals, particularly in the development of drugs targeting specific biological pathways. Its unique combination of functional groups may also allow for further derivatization, enhancing its utility in research and development. As with many organic compounds, its physical properties, such as solubility and melting point, would depend on the specific conditions under which it is studied.
Formula:C15H16N2O5
InChI:InChI=1S/C15H16N2O5/c1-15(2,3)21-14(20)16-10-6-4-5-9(7-10)12-8-11(13(18)19)17-22-12/h4-8H,1-3H3,(H,16,20)(H,18,19)
InChI key:InChIKey=WZZBZIHTTQNVAO-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C=C(ON1)C2=CC(NC(OC(C)(C)C)=O)=CC=C2
Synonyms:
  • 3-Isoxazolecarboxylic acid, 5-[3-[[(1,1-dimethylethoxy)carbonyl]amino]phenyl]-
  • 5-[3-[[(1,1-Dimethylethoxy)carbonyl]amino]phenyl]-3-isoxazolecarboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.