CAS 1263283-82-4

2-Chloro-4-propoxybenzaldehyde

Description:

2-Chloro-4-propoxybenzaldehyde is an organic compound characterized by its aromatic structure, featuring a benzaldehyde functional group with a propoxy substituent and a chlorine atom. The presence of the chlorine atom at the second position and the propoxy group at the fourth position on the benzene ring influences its chemical reactivity and physical properties. This compound typically exhibits a moderate boiling point and solubility in organic solvents, reflecting its hydrophobic nature due to the aromatic and alkyl components. It may participate in various chemical reactions, including electrophilic aromatic substitution and nucleophilic addition, owing to the electron-withdrawing effect of the chlorine atom and the electron-donating nature of the propoxy group. Additionally, 2-Chloro-4-propoxybenzaldehyde can serve as an intermediate in the synthesis of more complex organic molecules, making it valuable in pharmaceutical and agrochemical research. Safety data should be consulted for handling and storage, as it may pose health risks typical of chlorinated organic compounds.

Formula: C₁₀H₁₁ClO₂

InChI: InChI=1S/C10H11ClO2/c1-2-5-13-9-4-3-8(7-12)10(11)6-9/h3-4,6-7H,2,5H2,1H3

InChI key: InChIKey=VNJRRSAJKPLVEP-UHFFFAOYSA-N

SMILES: O(CCC)C1=CC(Cl)=C(C=O)C=C1

Synonyms:

• 2-Chloro-4-propoxybenzaldehyde
• Benzaldehyde, 2-chloro-4-propoxy-