CymitQuimica logo

CAS 1263284-50-9

:

Methyl 2-fluoro-4-(1,1,2,2,2-pentafluoroethyl)benzoate

Description:
Methyl 2-fluoro-4-(1,1,2,2,2-pentafluoroethyl)benzoate is a fluorinated aromatic compound characterized by the presence of both a methyl ester functional group and a pentafluoroethyl substituent. This compound features a benzoate structure, where the benzoic acid moiety is esterified with methanol, resulting in the methyl ester. The presence of the fluorine atoms contributes to its unique chemical properties, such as increased lipophilicity and potential applications in pharmaceuticals and agrochemicals. The fluorinated groups can enhance the compound's stability and reactivity, making it of interest in various chemical syntheses and applications. Additionally, the specific arrangement of the substituents on the benzene ring influences its electronic properties and reactivity patterns. As with many fluorinated compounds, it may exhibit low volatility and high thermal stability, which can be advantageous in certain industrial applications. Safety and handling considerations are essential due to the potential toxicity associated with fluorinated compounds.
Formula:C10H6F6O2
InChI:InChI=1S/C10H6F6O2/c1-18-8(17)6-3-2-5(4-7(6)11)9(12,13)10(14,15)16/h2-4H,1H3
InChI key:InChIKey=SOMILTAXJGMMPX-UHFFFAOYSA-N
SMILES:C(C(F)(F)F)(F)(F)C1=CC(F)=C(C(OC)=O)C=C1
Synonyms:
  • Benzoic acid, 2-fluoro-4-(1,1,2,2,2-pentafluoroethyl)-, methyl ester
  • Methyl 2-fluoro-4-(1,1,2,2,2-pentafluoroethyl)benzoate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.