CymitQuimica logo

CAS 1263284-55-4

:

3-(6-Bromoimidazo[1,2-b]pyridazin-2-yl)benzonitrile

Description:
3-(6-Bromoimidazo[1,2-b]pyridazin-2-yl)benzonitrile is a chemical compound characterized by its complex structure, which includes an imidazo[1,2-b]pyridazine moiety and a benzonitrile group. The presence of the bromine atom introduces notable electrophilic properties, potentially enhancing its reactivity in various chemical reactions. This compound is typically classified as a heterocyclic aromatic compound, which may exhibit interesting biological activities due to its structural features. The nitrile functional group contributes to its polarity and can participate in hydrogen bonding, influencing its solubility in different solvents. Additionally, the compound may possess potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, owing to its unique scaffold that can interact with biological targets. Its synthesis and characterization would involve standard organic chemistry techniques, and it may be of interest in research areas such as drug discovery or materials science. As with many brominated compounds, considerations regarding environmental impact and safety are essential during handling and application.
Formula:C13H7BrN4
InChI:InChI=1S/C13H7BrN4/c14-12-4-5-13-16-11(8-18(13)17-12)10-3-1-2-9(6-10)7-15/h1-6,8H
InChI key:InChIKey=HSSZIFFCNFVRKS-UHFFFAOYSA-N
SMILES:C(#N)C=1C=C(C2=CN3C(=N2)C=CC(Br)=N3)C=CC1
Synonyms:
  • 3-(6-Bromoimidazo[1,2-b]pyridazin-2-yl)benzonitrile
  • Benzonitrile, 3-(6-bromoimidazo[1,2-b]pyridazin-2-yl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.