CAS 1263286-39-0

Benzenemethanamine, 4-methoxy-2-(trifluoromethoxy)-, hydrochloride (1:1)

Description:

Benzenemethanamine, 4-methoxy-2-(trifluoromethoxy)-, hydrochloride (1:1), with the CAS number 1263286-39-0, is a chemical compound characterized by its aromatic amine structure. This substance features a benzene ring substituted with a methoxy group and a trifluoromethoxy group, which contributes to its unique chemical properties. The presence of the trifluoromethoxy group enhances its lipophilicity and may influence its biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, facilitating its use in various applications, including pharmaceuticals and research. The compound may exhibit specific pharmacological properties due to its amine functionality, which can interact with biological targets. Its synthesis and handling require careful consideration of safety protocols, particularly due to the presence of fluorinated groups, which can pose environmental and health risks. Overall, this compound represents a class of chemicals with potential utility in medicinal chemistry and related fields.

Formula: C₉H₁₀F₃NO₂·ClH

InChI: InChI=1S/C9H10F3NO2.ClH/c1-14-7-3-2-6(5-13)8(4-7)15-9(10,11)12;/h2-4H,5,13H2,1H3;1H

InChI key: InChIKey=SHZHCPMMRVOHFK-UHFFFAOYSA-N

SMILES: O(C(F)(F)F)C1=C(CN)C=CC(OC)=C1.Cl

Synonyms:

• Benzenemethanamine, 4-methoxy-2-(trifluoromethoxy)-, hydrochloride (1:1)