
CAS 1263286-67-4
:2,3-Dihydro-N-hydroxy-5-benzofurancarboximidoyl chloride
Description:
2,3-Dihydro-N-hydroxy-5-benzofurancarboximidoyl chloride is a chemical compound characterized by its unique structure, which includes a benzofuran moiety and an imidoyl chloride functional group. This compound typically exhibits properties associated with both the benzofuran and imidoyl chloride functionalities, such as potential reactivity towards nucleophiles due to the presence of the imidoyl chloride group. It may also display moderate solubility in organic solvents, reflecting the hydrophobic nature of the benzofuran ring. The hydroxyl group contributes to its potential as a reactive intermediate in organic synthesis, particularly in the formation of various derivatives. Additionally, the compound may have applications in medicinal chemistry, given the presence of functional groups that can participate in further chemical transformations. Safety data and handling precautions should be considered, as imidoyl chlorides can be reactive and may pose hazards. Overall, this compound represents a versatile building block in synthetic organic chemistry.
Formula:C9H8ClNO2
InChI:InChI=1S/C9H8ClNO2/c10-9(11-12)7-1-2-8-6(5-7)3-4-13-8/h1-2,5,12H,3-4H2
InChI key:InChIKey=YFKNLMTWFZGCEK-UHFFFAOYSA-N
SMILES:C(=NO)(Cl)C=1C=C2C(=CC1)OCC2
Synonyms:- 5-Benzofurancarboximidoyl chloride, 2,3-dihydro-N-hydroxy-
- 2,3-Dihydro-N-hydroxy-5-benzofurancarboximidoyl chloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.