CAS 1263296-82-7
:2-(Diphenylmethyl)-2-azaspiro[3.3]heptan-5-amine
Description:
2-(Diphenylmethyl)-2-azaspiro[3.3]heptan-5-amine, identified by its CAS number 1263296-82-7, is a chemical compound characterized by its unique spirocyclic structure, which incorporates a nitrogen atom within a bicyclic framework. This compound features a diphenylmethyl group, contributing to its potential as a ligand in various chemical reactions or as a pharmacophore in medicinal chemistry. The presence of the amine functional group suggests that it may exhibit basic properties and participate in hydrogen bonding, influencing its solubility and reactivity. The spirocyclic nature of the molecule may impart rigidity, potentially affecting its conformational dynamics and interactions with biological targets. Additionally, compounds of this type may be investigated for their biological activities, including potential applications in drug development. Overall, the structural characteristics of 2-(Diphenylmethyl)-2-azaspiro[3.3]heptan-5-amine suggest a compound of interest in both synthetic and medicinal chemistry contexts.
Formula:C19H22N2
InChI:InChI=1S/C19H22N2/c20-17-11-12-19(17)13-21(14-19)18(15-7-3-1-4-8-15)16-9-5-2-6-10-16/h1-10,17-18H,11-14,20H2
InChI key:InChIKey=DSZKDNIUEMPRKJ-UHFFFAOYSA-N
SMILES:NC1C2(CN(C(C3=CC=CC=C3)C4=CC=CC=C4)C2)CC1
Synonyms:- 2-Benzhydryl-2-azaspiro[3.3]heptan-5-amine
- 2-Azaspiro[3.3]heptan-5-amine, 2-(diphenylmethyl)-
- 2-(Diphenylmethyl)-2-azaspiro[3.3]heptan-5-amine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.