![Carbamic acid, [(3R)-2-oxo-3-oxetanyl]-, 1,1-dimethylethyl ester (9CI)](https://cymitquimica.com/_next/image/?url=https%3A%2Fstatic.cymitquimica.com%2Fcas-image%2Fthumb-webp%2F35098-carbamic-acid-3r-2-oxo-3-oxetanyl-11-dimethylethyl-ester-9ci.webp&w=3840&q=75)
CAS 126330-77-6
:Carbamic acid, [(3R)-2-oxo-3-oxetanyl]-, 1,1-dimethylethyl ester (9CI)
Description:
Carbamic acid, [(3R)-2-oxo-3-oxetanyl]-, 1,1-dimethylethyl ester, also known by its CAS number 126330-77-6, is an organic compound characterized by its carbamate functional group. This substance features a unique oxetane ring structure, which contributes to its chemical reactivity and potential applications. The presence of the dimethyl group indicates that it has branched alkyl characteristics, which can influence its solubility and volatility. As a carbamate, it may exhibit properties typical of this class, such as being a potential inhibitor of certain enzymes or having herbicidal activity. The stereochemistry denoted by (3R) suggests that the compound has specific spatial arrangements that can affect its biological interactions and efficacy. Overall, this compound's unique structure and functional groups make it of interest in various fields, including pharmaceuticals and agrochemicals, although specific applications would depend on further research and development.
Formula:C8H13NO4
InChI:InChI=1/C8H13NO4/c1-8(2,3)13-7(11)9-5-4-12-6(5)10/h5H,4H2,1-3H3,(H,9,11)/t5-/m1/s1
SMILES:CC(C)(C)OC(=N[C@@H]1COC1=O)O
Synonyms:- N-(tert-Butoxycarbonyl)-D-serine b-Lactone
- tert-butyl [(3R)-2-oxooxetan-3-yl]carbamate
Sort by
Found 4 products.
Ref: 54-OR471686
1g61.00€5g261.00€25g1,136.00€100mg32.00€250mg36.00€N-(tert-Butoxycarbonyl)-D-serine β-lactone
CAS:Formula:C8H13NO4Purity:97%Color and Shape:SolidMolecular weight:187.1931Ref: IN-DA000SNH
1g69.00€5g157.00€10g290.00€25g584.00€100mg25.00€250mg33.00€Ref: 10-F093748
1g57.00€5g221.00€10g405.00€250mg17.00€N-(tert-Butoxycarbonyl)-D-serine β-Lactone
CAS:Formula:C8H13NO4Purity:>98.0%(N)Color and Shape:White to Almost white powder to crystalineMolecular weight:187.20Ref: 3B-B6218
1g183.00€250mg71.00€