CymitQuimica logo

CAS 126334-26-7

:

4'-Bromononanophenone, 98%

Description:
4'-Bromononanophenone is an organic compound characterized by its bromine substituent and ketone functional group. It belongs to the class of aryl ketones, where a bromine atom is attached to the para position of a nonanophenone structure. This compound typically appears as a solid or crystalline substance and is known for its moderate solubility in organic solvents such as ethanol and acetone, while being less soluble in water due to its hydrophobic nonane chain. The presence of the bromine atom can influence its reactivity, making it a useful intermediate in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. Additionally, the compound may exhibit specific physical properties such as melting and boiling points that are characteristic of similar aryl ketones. Safety data sheets should be consulted for handling and storage guidelines, as it may pose health risks if inhaled or ingested. Overall, 4'-Bromononanophenone serves as a valuable compound in various chemical applications.
Formula:C15H21BrO
InChI:InChI=1/C15H21BrO/c1-2-3-4-5-6-7-8-15(17)13-9-11-14(16)12-10-13/h9-12H,2-8H2,1H3
SMILES:CCCCCCCCC(=O)c1ccc(cc1)Br
Synonyms:
  • 1-(4-Bromophenyl)Nonan-1-One
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.