CAS 126334-37-0
:B-(2,3-Difluoro-4-heptylphenyl)boronic acid
Description:
B-(2,3-Difluoro-4-heptylphenyl)boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a phenyl ring that is substituted with two fluorine atoms and a heptyl chain. This compound typically exhibits properties associated with boronic acids, such as the ability to form reversible complexes with diols, making it useful in various applications including organic synthesis and materials science. The presence of fluorine atoms can enhance the compound's lipophilicity and influence its electronic properties, potentially affecting its reactivity and interactions in biological systems. The heptyl chain contributes to the hydrophobic character of the molecule, which may impact its solubility in organic solvents. Overall, B-(2,3-Difluoro-4-heptylphenyl)boronic acid is of interest in research fields such as medicinal chemistry and polymer science, where its unique structural features can be leveraged for specific applications.
Formula:C13H19BF2O2
InChI:InChI=1S/C13H19BF2O2/c1-2-3-4-5-6-7-10-8-9-11(14(17)18)13(16)12(10)15/h8-9,17-18H,2-7H2,1H3
InChI key:InChIKey=WVEIGGAYFCCBSA-UHFFFAOYSA-N
SMILES:C(CCCCCC)C1=C(F)C(F)=C(B(O)O)C=C1
Synonyms:- Boronic acid, (2,3-difluoro-4-heptylphenyl)-
- Boronic acid, B-(2,3-difluoro-4-heptylphenyl)-
- (2,3-Difluoro-4-heptylphenyl)boronic acid
- B-(2,3-Difluoro-4-heptylphenyl)boronic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
