
CAS 126334-38-1
:B-(2,3-Difluoro-4-nonylphenyl)boronic acid
Description:
B-(2,3-Difluoro-4-nonylphenyl)boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group, which is known for its ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and materials science. The structure features a nonylphenyl group substituted with two fluorine atoms at the 2 and 3 positions, which can influence the compound's electronic properties and hydrophobicity. The presence of the boronic acid group imparts acidity, allowing it to participate in acid-base reactions. This compound is typically used in the development of sensors, pharmaceuticals, and as a building block in organic synthesis. Its unique fluorinated structure may enhance its stability and reactivity in certain chemical environments. Additionally, the nonyl chain contributes to its lipophilicity, which can affect its solubility in organic solvents. Overall, B-(2,3-Difluoro-4-nonylphenyl)boronic acid is a versatile compound with significant potential in various chemical applications.
Formula:C15H23BF2O2
InChI:InChI=1S/C15H23BF2O2/c1-2-3-4-5-6-7-8-9-12-10-11-13(16(19)20)15(18)14(12)17/h10-11,19-20H,2-9H2,1H3
InChI key:InChIKey=YZPYBLLARCIZPU-UHFFFAOYSA-N
SMILES:C(CCCCCCCC)C1=C(F)C(F)=C(B(O)O)C=C1
Synonyms:- (2,3-Difluoro-4-nonylphenyl)boronic acid
- B-(2,3-Difluoro-4-nonylphenyl)boronic acid
- Boronic acid, B-(2,3-difluoro-4-nonylphenyl)-
- Boronic acid, (2,3-difluoro-4-nonylphenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
