CymitQuimica logo

CAS 126335-09-9

:

5-[2-(difluoromethoxy)phenyl]-3-methyl-7-oxo-8-oxa-2-azabicyclo[4.3.0] nona-1,3,5-triene-4-carbonitrile

Description:
The chemical substance known as 5-[2-(difluoromethoxy)phenyl]-3-methyl-7-oxo-8-oxa-2-azabicyclo[4.3.0]nona-1,3,5-triene-4-carbonitrile, with the CAS number 126335-09-9, is a complex organic compound characterized by its bicyclic structure, which includes both nitrogen and oxygen heteroatoms. This compound features a difluoromethoxy group, contributing to its unique reactivity and potential biological activity. The presence of a carbonitrile functional group indicates that it may exhibit significant polar characteristics, influencing its solubility and interaction with biological systems. The bicyclic framework suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural complexity and the presence of multiple functional groups that can participate in various chemical reactions. Additionally, the compound's specific stereochemistry and electronic properties may play a crucial role in its biological activity, making it a subject of interest for further research in drug design and development.
Formula:C16H10F2N2O3
InChI:InChI=1/C16H10F2N2O3/c1-8-10(6-19)13(14-11(20-8)7-22-15(14)21)9-4-2-3-5-12(9)23-16(17)18/h2-5,16H,7H2,1H3
SMILES:Cc1c(C#N)c(c2ccccc2OC(F)F)c2c(COC2=O)n1
Synonyms:
  • Brn 4270244
  • 5,7-Dihydro-4-(2-(difluoromethoxy)phenyl)-2-methyl-5-oxofuro(3,4-b)pyridine-3-carbonitrile
  • Furo(3,4-b)pyridine-3-carbonitrile, 5,7-dihydro-4-(2-(difluoromethoxy)phenyl)-2-methyl-5-oxo-
  • 4-[2-(Difluoromethoxy)Phenyl]-2-Methyl-5-Oxo-5,7-Dihydrofuro[3,4-B]Pyridine-3-Carbonitrile
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.