CAS 1263365-47-4
:rel-(3aR,7aS)-Octahydro-1H-isoindol-5-ol
Description:
Rel-(3aR,7aS)-Octahydro-1H-isoindol-5-ol is a bicyclic organic compound characterized by its unique structural framework, which includes a saturated octahydroisoindole core. This compound features a hydroxyl (-OH) group at the 5-position, contributing to its potential reactivity and solubility in polar solvents. The stereochemistry indicated by the rel-(3aR,7aS) designation suggests specific spatial arrangements of the atoms, which can influence its biological activity and interactions with other molecules. Typically, compounds of this nature may exhibit properties such as moderate to high polarity, making them suitable for various applications in medicinal chemistry and organic synthesis. The presence of the hydroxyl group also suggests potential for hydrogen bonding, which can affect the compound's physical properties, such as boiling and melting points. Overall, rel-(3aR,7aS)-Octahydro-1H-isoindol-5-ol is of interest for its structural features and potential utility in pharmaceutical development and research.
Formula:C8H15NO
InChI:InChI=1/C8H15NO/c10-8-2-1-6-4-9-5-7(6)3-8/h6-10H,1-5H2/t6-,7+,8?/s2
InChI key:InChIKey=DPOLLBMYIRHSRA-JHEDNKFWNA-N
SMILES:OC1C[C@]2([C@@](CC1)(CNC2)[H])[H]
Synonyms:- rel-(3aR,7aS)-Octahydro-1H-isoindol-5-ol
- 1H-Isoindol-5-ol, octahydro-, (3aR,7aS)-rel-
- OCTAHYDRO-ISOINDOL-5-OL HCL
- octahydroisoindol-5-ol hydrochloride
- cis-Octahydro-isoindol-5-ol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
