CAS 1263365-48-5
:2-(1,3-Dioxolan-2-yl)-1-(3-iodophenyl)ethanone
Description:
2-(1,3-Dioxolan-2-yl)-1-(3-iodophenyl)ethanone is a chemical compound characterized by its unique structural features, which include a dioxolane ring and an iodophenyl group. The presence of the dioxolane moiety suggests that this compound may exhibit properties typical of cyclic ethers, such as increased stability and potential reactivity in nucleophilic substitution reactions. The iodophenyl group introduces halogen functionality, which can enhance the compound's reactivity and influence its electronic properties, making it potentially useful in various synthetic applications. This compound may also exhibit interesting biological activities due to the combination of its functional groups, which could be explored in medicinal chemistry. Additionally, the presence of the carbonyl group in the ethanone structure indicates potential for further chemical transformations, such as reduction or condensation reactions. Overall, 2-(1,3-Dioxolan-2-yl)-1-(3-iodophenyl)ethanone presents a versatile framework for further exploration in both synthetic and applied chemistry contexts.
Formula:C11H11IO3
InChI:InChI=1S/C11H11IO3/c12-9-3-1-2-8(6-9)10(13)7-11-14-4-5-15-11/h1-3,6,11H,4-5,7H2
InChI key:InChIKey=VEAOXGIGOSXIEG-UHFFFAOYSA-N
SMILES:C(CC1OCCO1)(=O)C2=CC(I)=CC=C2
Synonyms:- 2-(1,3-Dioxolan-2-yl)-1-(3-iodophenyl)ethanone
- Ethanone, 2-(1,3-dioxolan-2-yl)-1-(3-iodophenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.