CAS 1263365-49-6

1-(3,4-Dichlorophenyl)-2-(1,3-dioxolan-2-yl)ethanone

Description:

1-(3,4-Dichlorophenyl)-2-(1,3-dioxolan-2-yl)ethanone, identified by its CAS number 1263365-49-6, is an organic compound characterized by its unique structural features. It contains a dichlorophenyl group, which contributes to its potential biological activity, and a dioxolane ring that enhances its stability and solubility in organic solvents. The presence of the ethanone functional group indicates that it is a ketone, which may influence its reactivity and interactions with other chemical species. This compound is likely to exhibit moderate to high lipophilicity due to the aromatic and aliphatic components, which can affect its pharmacokinetic properties if it is studied for medicinal applications. Additionally, the dichlorophenyl moiety may impart specific electronic properties, making it a candidate for various chemical reactions, including nucleophilic substitutions or electrophilic additions. Overall, the combination of these structural elements suggests that this compound could have interesting applications in fields such as pharmaceuticals, agrochemicals, or materials science, pending further investigation into its specific properties and behaviors.

Formula: C₁₁H₁₀Cl₂O₃

InChI: InChI=1S/C11H10Cl2O3/c12-8-2-1-7(5-9(8)13)10(14)6-11-15-3-4-16-11/h1-2,5,11H,3-4,6H2

InChI key: InChIKey=GQYIWEIDOKUONP-UHFFFAOYSA-N

SMILES: C(CC1OCCO1)(=O)C2=CC(Cl)=C(Cl)C=C2

Synonyms:

• Ethanone, 1-(3,4-dichlorophenyl)-2-(1,3-dioxolan-2-yl)-
• 1-(3,4-Dichlorophenyl)-2-(1,3-dioxolan-2-yl)ethanone