CymitQuimica logo

CAS 1263365-53-2

:

1-(1,3-Dioxolan-2-yl)-2-undecanone

Description:
1-(1,3-Dioxolan-2-yl)-2-undecanone, with the CAS number 1263365-53-2, is an organic compound characterized by its unique structure that includes a dioxolane ring and a long hydrocarbon chain. This compound features a ketone functional group, which contributes to its reactivity and potential applications in organic synthesis. The presence of the dioxolane moiety suggests that it may exhibit properties such as increased stability and solubility in various solvents. Additionally, the long undecane chain may impart hydrophobic characteristics, influencing its behavior in biological systems and its interactions with other molecules. This compound may be of interest in fields such as fragrance chemistry, where it could serve as a synthetic intermediate or a potential fragrance component due to its structural features. Its specific physical properties, such as boiling point, melting point, and solubility, would depend on the molecular interactions and the environment in which it is studied. Overall, 1-(1,3-Dioxolan-2-yl)-2-undecanone represents a versatile compound with potential applications in various chemical industries.
Formula:C14H26O3
InChI:InChI=1S/C14H26O3/c1-2-3-4-5-6-7-8-9-13(15)12-14-16-10-11-17-14/h14H,2-12H2,1H3
InChI key:InChIKey=GRJBGOUTVWBKSN-UHFFFAOYSA-N
SMILES:C(C(CCCCCCCCC)=O)C1OCCO1
Synonyms:
  • 1-(1,3-Dioxolan-2-yl)-2-undecanone
  • 2-Undecanone, 1-(1,3-dioxolan-2-yl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.