CAS 1263365-54-3
:2-(1,3-Dioxolan-2-yl)-1-[4-(1-methylethyl)phenyl]ethanone
Description:
2-(1,3-Dioxolan-2-yl)-1-[4-(1-methylethyl)phenyl]ethanone, identified by its CAS number 1263365-54-3, is an organic compound characterized by its unique structural features. It contains a dioxolane ring, which contributes to its stability and reactivity, and an acetophenone moiety that enhances its potential applications in organic synthesis and material science. The presence of the isopropyl group on the phenyl ring suggests that the compound may exhibit hydrophobic properties, influencing its solubility in various solvents. This compound may also display interesting photochemical properties due to the presence of the carbonyl group, making it a candidate for use in photoinitiators or as a building block in the synthesis of more complex organic molecules. Additionally, its structural characteristics may allow for interactions with biological systems, warranting further investigation into its potential pharmacological applications. Overall, this compound represents a versatile structure with implications in both synthetic chemistry and potential industrial applications.
Formula:C14H18O3
InChI:InChI=1S/C14H18O3/c1-10(2)11-3-5-12(6-4-11)13(15)9-14-16-7-8-17-14/h3-6,10,14H,7-9H2,1-2H3
InChI key:InChIKey=AZQQHXQUCKJQSF-UHFFFAOYSA-N
SMILES:C(CC1OCCO1)(=O)C2=CC=C(C(C)C)C=C2
Synonyms:- Ethanone, 2-(1,3-dioxolan-2-yl)-1-[4-(1-methylethyl)phenyl]-
- 2-(1,3-Dioxolan-2-yl)-1-[4-(1-methylethyl)phenyl]ethanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.