CAS 1263365-55-4
:2-(1,3-Dioxolan-2-yl)-1-(3-methoxyphenyl)ethanone
Description:
2-(1,3-Dioxolan-2-yl)-1-(3-methoxyphenyl)ethanone is an organic compound characterized by its unique structural features, which include a dioxolane ring and a methoxy-substituted phenyl group. The presence of the dioxolane moiety suggests that this compound may exhibit properties typical of cyclic ethers, such as increased stability and potential reactivity in nucleophilic substitution reactions. The methoxy group on the phenyl ring can influence the compound's electronic properties, potentially enhancing its reactivity and solubility in organic solvents. This compound may also exhibit interesting biological activities, making it a candidate for further research in medicinal chemistry. Its molecular structure allows for various functionalization possibilities, which can be explored for applications in pharmaceuticals or materials science. Additionally, the compound's CAS number, 1263365-55-4, serves as a unique identifier for regulatory and safety information, facilitating its study and use in various chemical contexts. Overall, this compound's distinctive features make it a subject of interest in both synthetic and applied chemistry.
Formula:C12H14O4
InChI:InChI=1S/C12H14O4/c1-14-10-4-2-3-9(7-10)11(13)8-12-15-5-6-16-12/h2-4,7,12H,5-6,8H2,1H3
InChI key:InChIKey=RSVZCPSKSZGAFL-UHFFFAOYSA-N
SMILES:C(CC1OCCO1)(=O)C2=CC(OC)=CC=C2
Synonyms:- 2-(1,3-Dioxolan-2-yl)-1-(3-methoxyphenyl)ethanone
- Ethanone, 2-(1,3-dioxolan-2-yl)-1-(3-methoxyphenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.