CAS 1263365-58-7

2-(1,3-Dioxolan-2-yl)-1-(4-propoxyphenyl)ethanone

Description:

2-(1,3-Dioxolan-2-yl)-1-(4-propoxyphenyl)ethanone is an organic compound characterized by its unique structural features, which include a dioxolane ring and a propoxyphenyl group. The presence of the dioxolane moiety suggests that this compound may exhibit properties such as increased stability and potential for solvation in polar solvents. The propoxyphenyl group contributes to its aromatic character, which can influence its reactivity and interaction with other chemical species. This compound may be of interest in various applications, including organic synthesis, pharmaceuticals, and materials science, due to its potential as a building block or intermediate in chemical reactions. Additionally, the presence of functional groups may impart specific properties such as solubility, polarity, and reactivity, making it suitable for targeted applications. As with many organic compounds, its behavior in different environments, including thermal stability and reactivity with nucleophiles or electrophiles, would be essential for understanding its practical uses. Safety and handling precautions should be observed, as with any chemical substance, due to potential hazards associated with its use.

Formula: C₁₄H₁₈O₄

InChI: InChI=1S/C14H18O4/c1-2-7-16-12-5-3-11(4-6-12)13(15)10-14-17-8-9-18-14/h3-6,14H,2,7-10H2,1H3

InChI key: InChIKey=LIVATNKSGUAWNT-UHFFFAOYSA-N

SMILES: C(CC1OCCO1)(=O)C2=CC=C(OCCC)C=C2

Synonyms:

• 2-(1,3-Dioxolan-2-yl)-1-(4-propoxyphenyl)ethanone
• Ethanone, 2-(1,3-dioxolan-2-yl)-1-(4-propoxyphenyl)-