CymitQuimica logo

CAS 1263365-62-3

:

1-(2-Chloro-3-pyridinyl)-2-(1,3-dioxolan-2-yl)ethanone

Description:
1-(2-Chloro-3-pyridinyl)-2-(1,3-dioxolan-2-yl)ethanone is a chemical compound characterized by its unique structural features, which include a pyridine ring and a dioxolane moiety. The presence of the chloro substituent on the pyridine ring contributes to its reactivity and potential biological activity. This compound typically exhibits properties such as moderate solubility in organic solvents and may have limited solubility in water due to its hydrophobic dioxolane component. The dioxolane ring can influence the compound's stability and reactivity, particularly in nucleophilic substitution reactions. Additionally, the ethanone functional group suggests potential for ketone-related reactivity, including oxidation and condensation reactions. Its specific applications may vary, but compounds with similar structures are often explored in medicinal chemistry for their potential therapeutic effects. Overall, the combination of functional groups in this compound suggests a versatile chemical behavior, making it of interest in various fields, including pharmaceuticals and agrochemicals.
Formula:C10H10ClNO3
InChI:InChI=1S/C10H10ClNO3/c11-10-7(2-1-3-12-10)8(13)6-9-14-4-5-15-9/h1-3,9H,4-6H2
InChI key:InChIKey=UQIFMNQCHQAPNC-UHFFFAOYSA-N
SMILES:C(CC1OCCO1)(=O)C2=C(Cl)N=CC=C2
Synonyms:
  • 1-(2-Chloro-3-pyridinyl)-2-(1,3-dioxolan-2-yl)ethanone
  • Ethanone, 1-(2-chloro-3-pyridinyl)-2-(1,3-dioxolan-2-yl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.