CAS 1263365-66-7
:1-(2,3-Dimethoxyphenyl)-2-(1,3-dioxolan-2-yl)ethanone
Description:
1-(2,3-Dimethoxyphenyl)-2-(1,3-dioxolan-2-yl)ethanone, with the CAS number 1263365-66-7, is an organic compound characterized by its complex structure that includes a phenyl ring substituted with two methoxy groups and a dioxolane moiety. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as moderate polarity and potential for hydrogen bonding due to the presence of the dioxolane ring. The methoxy groups can influence the compound's electronic properties, potentially enhancing its reactivity or solubility in organic solvents. It may also display interesting biological activities, making it a subject of interest in medicinal chemistry. The presence of the dioxolane ring suggests potential applications in the synthesis of more complex molecules or as intermediates in organic synthesis. Overall, this compound's unique structural features contribute to its potential utility in various chemical and pharmaceutical applications.
Formula:C13H16O5
InChI:InChI=1S/C13H16O5/c1-15-11-5-3-4-9(13(11)16-2)10(14)8-12-17-6-7-18-12/h3-5,12H,6-8H2,1-2H3
InChI key:InChIKey=JVIVRHHFNMROCX-UHFFFAOYSA-N
SMILES:C(CC1OCCO1)(=O)C2=C(OC)C(OC)=CC=C2
Synonyms:- 1-(2,3-Dimethoxyphenyl)-2-(1,3-dioxolan-2-yl)ethanone
- Ethanone, 1-(2,3-dimethoxyphenyl)-2-(1,3-dioxolan-2-yl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.