CAS 1263365-68-9
:2-(1,3-Dioxolan-2-yl)-1-(4-propylphenyl)ethanone
Description:
2-(1,3-Dioxolan-2-yl)-1-(4-propylphenyl)ethanone, identified by its CAS number 1263365-68-9, is an organic compound characterized by its unique structure that includes a dioxolane ring and a propyl-substituted phenyl group. This compound typically exhibits properties associated with ketones, such as being a liquid at room temperature and having a moderate boiling point. The presence of the dioxolane moiety suggests potential for solubility in polar solvents, while the propylphenyl group may contribute to hydrophobic characteristics. Its molecular structure indicates potential applications in organic synthesis, possibly as an intermediate in the production of more complex molecules. Additionally, the compound may exhibit interesting reactivity due to the functional groups present, making it a candidate for further study in fields such as medicinal chemistry or materials science. Safety data and handling precautions should be considered, as with any chemical substance, to ensure proper usage and minimize risks.
Formula:C14H18O3
InChI:InChI=1S/C14H18O3/c1-2-3-11-4-6-12(7-5-11)13(15)10-14-16-8-9-17-14/h4-7,14H,2-3,8-10H2,1H3
InChI key:InChIKey=HDMMOLQXTOMNAQ-UHFFFAOYSA-N
SMILES:C(CC1OCCO1)(=O)C2=CC=C(CCC)C=C2
Synonyms:- Ethanone, 2-(1,3-dioxolan-2-yl)-1-(4-propylphenyl)-
- 2-(1,3-Dioxolan-2-yl)-1-(4-propylphenyl)ethanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.