CAS 1263365-70-3

1-(2,3-Dimethylphenyl)-2-(1,3-dioxolan-2-yl)ethanone

Description:

1-(2,3-Dimethylphenyl)-2-(1,3-dioxolan-2-yl)ethanone, identified by its CAS number 1263365-70-3, is an organic compound characterized by its unique structural features. It contains a ketone functional group, indicated by the ethanone moiety, and a dioxolane ring, which contributes to its cyclic ether characteristics. The presence of the 2,3-dimethylphenyl group suggests that the compound has aromatic properties, potentially influencing its reactivity and stability. This compound may exhibit moderate polarity due to the combination of the aromatic and ether functionalities, which can affect its solubility in various solvents. Additionally, the dioxolane ring can impart certain chemical reactivity, making it a candidate for various synthetic applications. The compound's molecular structure suggests potential uses in organic synthesis, possibly in the development of pharmaceuticals or agrochemicals. However, specific physical properties such as boiling point, melting point, and solubility would require empirical data for precise characterization. Overall, this compound represents a complex organic structure with potential utility in chemical research and applications.

Formula: C₁₃H₁₆O₃

InChI: InChI=1S/C13H16O3/c1-9-4-3-5-11(10(9)2)12(14)8-13-15-6-7-16-13/h3-5,13H,6-8H2,1-2H3

InChI key: InChIKey=GVHSGGZHVUCEAC-UHFFFAOYSA-N

SMILES: C(CC1OCCO1)(=O)C2=C(C)C(C)=CC=C2

Synonyms:

• 1-(2,3-Dimethylphenyl)-2-(1,3-dioxolan-2-yl)ethanone
• Ethanone, 1-(2,3-dimethylphenyl)-2-(1,3-dioxolan-2-yl)-