CAS 1263365-74-7
:1-(2,3-Difluorophenyl)-2-(1,3-dioxolan-2-yl)ethanone
Description:
1-(2,3-Difluorophenyl)-2-(1,3-dioxolan-2-yl)ethanone, identified by its CAS number 1263365-74-7, is an organic compound characterized by its unique structural features. It contains a difluorophenyl group, which contributes to its potential reactivity and interaction with biological systems. The presence of the 1,3-dioxolane ring adds to its stability and may influence its solubility and polarity. This compound is likely to exhibit specific chemical properties such as moderate to high lipophilicity due to the aromatic and fluorinated components, which can affect its bioavailability and pharmacokinetics if considered for pharmaceutical applications. Additionally, the carbonyl functional group (ethanone) suggests potential reactivity in nucleophilic addition reactions. Overall, the combination of these structural elements may impart interesting characteristics that could be explored in various chemical and biological contexts, including medicinal chemistry and material science. Further studies would be necessary to fully elucidate its properties and potential applications.
Formula:C11H10F2O3
InChI:InChI=1S/C11H10F2O3/c12-8-3-1-2-7(11(8)13)9(14)6-10-15-4-5-16-10/h1-3,10H,4-6H2
InChI key:InChIKey=CUZYHUOHWRRRBN-UHFFFAOYSA-N
SMILES:C(CC1OCCO1)(=O)C2=C(F)C(F)=CC=C2
Synonyms:- Ethanone, 1-(2,3-difluorophenyl)-2-(1,3-dioxolan-2-yl)-
- 1-(2,3-Difluorophenyl)-2-(1,3-dioxolan-2-yl)ethanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.