CAS 1263365-75-8

1-(2-Chloro-2-propen-1-yl)-2-ethylbenzene

Description:

1-(2-Chloro-2-propen-1-yl)-2-ethylbenzene, identified by its CAS number 1263365-75-8, is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with both an ethyl group and a propenyl group containing a chlorine atom. This compound typically exhibits properties associated with both alkenes and aromatic hydrocarbons, such as moderate volatility and potential reactivity due to the presence of the double bond and the chlorine substituent. The chlorine atom can influence the compound's reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. Additionally, the presence of the ethyl group may affect its solubility and interaction with other substances. As with many chlorinated compounds, it may also exhibit environmental persistence and potential toxicity, necessitating careful handling and consideration in applications. Overall, its unique structure suggests potential utility in organic synthesis and as an intermediate in the production of more complex chemical entities.

Formula: C₁₁H₁₃Cl

InChI: InChI=1S/C11H13Cl/c1-3-10-6-4-5-7-11(10)8-9(2)12/h4-7H,2-3,8H2,1H3

InChI key: InChIKey=NPWODWGAPOCPOS-UHFFFAOYSA-N

SMILES: C(C(=C)Cl)C1=C(CC)C=CC=C1

Synonyms:

• Benzene, 1-(2-chloro-2-propen-1-yl)-2-ethyl-
• 1-(2-Chloro-2-propen-1-yl)-2-ethylbenzene