CAS 1263365-77-0
:1-(2,5-Difluorophenyl)-2-(1,3-dioxolan-2-yl)ethanone
Description:
1-(2,5-Difluorophenyl)-2-(1,3-dioxolan-2-yl)ethanone, identified by its CAS number 1263365-77-0, is an organic compound characterized by its unique structural features. It contains a difluorophenyl group, which contributes to its electronic properties and potential reactivity, as well as a dioxolane ring that enhances its stability and solubility in various solvents. This compound is likely to exhibit moderate polarity due to the presence of both aromatic and heterocyclic components. The dioxolane moiety may also impart specific interactions with biological targets, making it of interest in medicinal chemistry. Additionally, the presence of fluorine atoms can influence the compound's lipophilicity and metabolic stability. Overall, this substance may be explored for applications in pharmaceuticals or agrochemicals, where its unique characteristics could be leveraged for specific biological activities or chemical reactivity. However, detailed studies would be necessary to fully understand its properties and potential uses.
Formula:C11H10F2O3
InChI:InChI=1S/C11H10F2O3/c12-7-1-2-9(13)8(5-7)10(14)6-11-15-3-4-16-11/h1-2,5,11H,3-4,6H2
InChI key:InChIKey=IKFREPWDPCDFML-UHFFFAOYSA-N
SMILES:C(CC1OCCO1)(=O)C2=C(F)C=CC(F)=C2
Synonyms:- 1-(2,5-Difluorophenyl)-2-(1,3-dioxolan-2-yl)ethanone
- Ethanone, 1-(2,5-difluorophenyl)-2-(1,3-dioxolan-2-yl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.