CymitQuimica logo

CAS 1263365-78-1

:

2-(1,3-Dioxolan-2-yl)-1-(3-phenoxyphenyl)ethanone

Description:
2-(1,3-Dioxolan-2-yl)-1-(3-phenoxyphenyl)ethanone is an organic compound characterized by its unique structural features, including a dioxolane ring and a phenoxyphenyl moiety. The presence of the dioxolane ring suggests that this compound may exhibit properties typical of cyclic ethers, such as increased stability and potential reactivity in nucleophilic substitution reactions. The phenoxyphenyl group contributes to its aromatic character, which can influence its solubility and interaction with other molecules. This compound may also exhibit interesting photophysical properties due to the conjugation between the aromatic systems, potentially making it useful in applications such as organic electronics or as a precursor in synthetic chemistry. Additionally, the presence of the ethanone functional group indicates that it may participate in various chemical reactions, including acylation and condensation reactions. Overall, the combination of these structural elements suggests that 2-(1,3-Dioxolan-2-yl)-1-(3-phenoxyphenyl)ethanone could have diverse applications in materials science and organic synthesis.
Formula:C17H16O4
InChI:InChI=1S/C17H16O4/c18-16(12-17-19-9-10-20-17)13-5-4-8-15(11-13)21-14-6-2-1-3-7-14/h1-8,11,17H,9-10,12H2
InChI key:InChIKey=NAFGMSHMDBNLDM-UHFFFAOYSA-N
SMILES:O(C1=CC(C(CC2OCCO2)=O)=CC=C1)C3=CC=CC=C3
Synonyms:
  • Ethanone, 2-(1,3-dioxolan-2-yl)-1-(3-phenoxyphenyl)-
  • 2-(1,3-Dioxolan-2-yl)-1-(3-phenoxyphenyl)ethanone
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.