CymitQuimica logo

CAS 1263365-83-8

:

1-(1,3-Dioxolan-2-yl)-2-dodecanone

Description:
1-(1,3-Dioxolan-2-yl)-2-dodecanone is an organic compound characterized by its unique structure, which includes a dioxolane ring and a long aliphatic dodecanone chain. This compound typically exhibits properties associated with both ketones and cyclic ethers, contributing to its potential applications in various fields, including fragrance and flavor industries, as well as in the synthesis of other organic compounds. The presence of the dioxolane moiety may impart stability and influence the compound's reactivity, while the dodecanone portion provides hydrophobic characteristics, making it soluble in organic solvents. Its molecular structure suggests it may have interesting physical properties, such as a moderate boiling point and a specific range of solubility in different solvents. Additionally, the compound's potential biological activity could be explored, although specific studies would be necessary to elucidate its behavior in biological systems. Overall, 1-(1,3-Dioxolan-2-yl)-2-dodecanone represents a versatile chemical entity with potential utility in various chemical applications.
Formula:C15H28O3
InChI:InChI=1S/C15H28O3/c1-2-3-4-5-6-7-8-9-10-14(16)13-15-17-11-12-18-15/h15H,2-13H2,1H3
InChI key:InChIKey=XSJNLPXPEQAJOR-UHFFFAOYSA-N
SMILES:C(C(CCCCCCCCCC)=O)C1OCCO1
Synonyms:
  • 2-Dodecanone, 1-(1,3-dioxolan-2-yl)-
  • 1-(1,3-Dioxolan-2-yl)-2-dodecanone
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.