CAS 1263365-84-9
:1-Cyclobutyl-2-(1,3-dioxolan-2-yl)ethanone
Description:
1-Cyclobutyl-2-(1,3-dioxolan-2-yl)ethanone is an organic compound characterized by its unique structure, which includes a cyclobutyl group and a dioxolane moiety. This compound features a ketone functional group, contributing to its reactivity and potential applications in organic synthesis. The presence of the dioxolane ring suggests that it may exhibit properties typical of cyclic ethers, such as increased stability and potential for ring-opening reactions under certain conditions. The cyclobutyl group can influence the compound's steric and electronic properties, potentially affecting its reactivity and interactions with other molecules. Additionally, the compound may exhibit interesting solubility characteristics due to the combination of polar and nonpolar regions in its structure. As with many organic compounds, its behavior in various chemical reactions, including nucleophilic attacks and oxidation, can be influenced by the specific functional groups present. Overall, 1-Cyclobutyl-2-(1,3-dioxolan-2-yl)ethanone represents a versatile structure that may find utility in synthetic organic chemistry and related fields.
Formula:C9H14O3
InChI:InChI=1S/C9H14O3/c10-8(7-2-1-3-7)6-9-11-4-5-12-9/h7,9H,1-6H2
InChI key:InChIKey=PGWQMSNYAIYWLG-UHFFFAOYSA-N
SMILES:C(CC1OCCO1)(=O)C2CCC2
Synonyms:- Ethanone, 1-cyclobutyl-2-(1,3-dioxolan-2-yl)-
- 1-Cyclobutyl-2-(1,3-dioxolan-2-yl)ethanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.